C17H28N4O5S2 — CID 166422553
3-[2-[[2-methyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazol-1-yl]propanoyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166422553) has the molecular formula C17H28N4O5S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 3-[2-[[2-methyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazol-1-yl]propanoyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[2-methyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazol-1-yl]propanoyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166422553 |
| Molecular Formula | C17H28N4O5S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-[2-[[2-methyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazol-1-yl]propanoyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ccn(C(C)(C)C(=O)NCCSSCCC(=O)O)n1 |
| InChI | InChI=1S/C17H28N4O5S2/c1-16(2,3)26-15(25)19-12-6-9-21(20-12)17(4,5)14(24)18-8-11-28-27-10-7-13(22)23/h6,9H,7-8,10-11H2,1-5H3,(H,18,24)(H,22,23)(H,19,20,25) |
| InChIKey | ASLULSVKRVTYPC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|