C14H23N3O2S — CID 163271558
tert-butyl 2-[3-(cyclopropylsulfanylamino)pyrazol-1-yl]-2-methylpropanoate (PubChem CID 163271558) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is tert-butyl 2-[3-(cyclopropylsulfanylamino)pyrazol-1-yl]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[3-(cyclopropylsulfanylamino)pyrazol-1-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 163271558 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | tert-butyl 2-[3-(cyclopropylsulfanylamino)pyrazol-1-yl]-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)n1ccc(NSC2CC2)n1 |
| InChI | InChI=1S/C14H23N3O2S/c1-13(2,3)19-12(18)14(4,5)17-9-8-11(15-17)16-20-10-6-7-10/h8-10H,6-7H2,1-5H3,(H,15,16) |
| InChIKey | MGMPBHWPPSONMF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|