About tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole
tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole (PubChem CID 159155368) has the molecular formula C22H37BrN4O4
and a molecular weight of 501.47 g/mol. Its IUPAC name is tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole.
Molecular Properties
| Compound Name | tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole |
| PubChem CID | 159155368 |
| Molecular Formula | C22H37BrN4O4 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole |
| SMILES | CC(C)(C)OC(=O)C(C)(C)Br.CC(C)(C)OC(=O)C(C)(C)n1cccn1.c1cn[nH]c1 |
| InChI | InChI=1S/C11H18N2O2.C8H15BrO2.C3H4N2/c1-10(2,3)15-9(14)11(4,5)13-8-6-7-12-13;1-7(2,3)11-6(10)8(4,5)9;1-2-4-5-3-1/h6-8H,1-5H3;1-5H3;1-3H,(H,4,5) |
| InChIKey | KJVCNYSPRQABFI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole?
The IUPAC name of tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole (CID 159155368) is tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole.
What is the SMILES notation for tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole?
The canonical SMILES for tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole is CC(C)(C)OC(=O)C(C)(C)Br.CC(C)(C)OC(=O)C(C)(C)n1cccn1.c1cn[nH]c1.
What is the InChIKey of tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole?
The InChIKey is KJVCNYSPRQABFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2.C8H15BrO2.C3H4N2/c1-10(2,3)15-9(14)11(4,5)13-8-6-7-12-13;1-7(2,3)11-6(10)8(4,5)9;1-2-4-5-3-1/h6-8H,1-5H3;1-5H3;1-3H,(H,4,5).
What are the key properties of tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole?
tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole has a molecular weight of 501.47 g/mol, XLogP of 4.87, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-bromo-2-methylpropanoate;tert-butyl 2-methyl-2-pyrazol-1-ylpropanoate;1H-pyrazole is sourced from PubChem (CID 159155368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).