About acetic acid;guanidine;1H-pyrazole
acetic acid;guanidine;1H-pyrazole (PubChem CID 174478894) has the molecular formula C6H13N5O2
and a molecular weight of 187.20 g/mol. Its IUPAC name is acetic acid;guanidine;1H-pyrazole.
Molecular Properties
| Compound Name | acetic acid;guanidine;1H-pyrazole |
| PubChem CID | 174478894 |
| Molecular Formula | C6H13N5O2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | acetic acid;guanidine;1H-pyrazole |
| SMILES | CC(=O)O.[H]N=C(N)N.c1cn[nH]c1 |
| InChI | InChI=1S/C3H4N2.C2H4O2.CH5N3/c1-2-4-5-3-1;1-2(3)4;2-1(3)4/h1-3H,(H,4,5);1H3,(H,3,4);(H5,2,3,4) |
| InChIKey | APACNLUIWCOAIR-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 141.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;guanidine;1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;guanidine;1H-pyrazole?
The IUPAC name of acetic acid;guanidine;1H-pyrazole (CID 174478894) is acetic acid;guanidine;1H-pyrazole.
What is the SMILES notation for acetic acid;guanidine;1H-pyrazole?
The canonical SMILES for acetic acid;guanidine;1H-pyrazole is CC(=O)O.[H]N=C(N)N.c1cn[nH]c1.
What is the InChIKey of acetic acid;guanidine;1H-pyrazole?
The InChIKey is APACNLUIWCOAIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.C2H4O2.CH5N3/c1-2-4-5-3-1;1-2(3)4;2-1(3)4/h1-3H,(H,4,5);1H3,(H,3,4);(H5,2,3,4).
What are the key properties of acetic acid;guanidine;1H-pyrazole?
acetic acid;guanidine;1H-pyrazole has a molecular weight of 187.20 g/mol, XLogP of -0.66, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;guanidine;1H-pyrazole is sourced from PubChem (CID 174478894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).