C16H23NO4S2 — CID 176905106
4-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyldisulfanyl]butanoic acid (PubChem CID 176905106) has the molecular formula C16H23NO4S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 4-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyldisulfanyl]butanoic acid.
| Compound Name | 4-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyldisulfanyl]butanoic acid |
|---|---|
| PubChem CID | 176905106 |
| Molecular Formula | C16H23NO4S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyldisulfanyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CSSCCCC(=O)O)cc1 |
| InChI | InChI=1S/C16H23NO4S2/c1-16(2,3)21-15(20)17-13-8-6-12(7-9-13)11-23-22-10-4-5-14(18)19/h6-9H,4-5,10-11H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | LMFFLMMCRABQFV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|