C16H24NO4P — CID 90364732
tert-butyl N-[4-(3-dimethylphosphoryl-2-oxopropyl)phenyl]carbamate (PubChem CID 90364732) has the molecular formula C16H24NO4P and a molecular weight of 325.35 g/mol. Its IUPAC name is tert-butyl N-[4-(3-dimethylphosphoryl-2-oxopropyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-dimethylphosphoryl-2-oxopropyl)phenyl]carbamate |
|---|---|
| PubChem CID | 90364732 |
| Molecular Formula | C16H24NO4P |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | tert-butyl N-[4-(3-dimethylphosphoryl-2-oxopropyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CC(=O)CP(C)(C)=O)cc1 |
| InChI | InChI=1S/C16H24NO4P/c1-16(2,3)21-15(19)17-13-8-6-12(7-9-13)10-14(18)11-22(4,5)20/h6-9H,10-11H2,1-5H3,(H,17,19) |
| InChIKey | SNIIMBRFCGTTAS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|