C17H27NO6S — CID 175451215
4-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]ethoxy]butanoic acid;sulfane (PubChem CID 175451215) has the molecular formula C17H27NO6S and a molecular weight of 373.47 g/mol. Its IUPAC name is 4-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]ethoxy]butanoic acid;sulfane.
| Compound Name | 4-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]ethoxy]butanoic acid;sulfane |
|---|---|
| PubChem CID | 175451215 |
| Molecular Formula | C17H27NO6S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]ethoxy]butanoic acid;sulfane |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(OCCOCCCC(=O)O)cc1.S |
| InChI | InChI=1S/C17H25NO6.H2S/c1-17(2,3)24-16(21)18-13-6-8-14(9-7-13)23-12-11-22-10-4-5-15(19)20;/h6-9H,4-5,10-12H2,1-3H3,(H,18,21)(H,19,20);1H2 |
| InChIKey | GAENLDFPRZBGKT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|