C20H29N3O7 — CID 147264482
4-[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-4-oxobutanoic acid (PubChem CID 147264482) has the molecular formula C20H29N3O7 and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 147264482 |
| Molecular Formula | C20H29N3O7 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 4-[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC(=O)CCC(=O)O)cc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H29N3O7/c1-19(2,3)29-17(27)22-13-9-12(21-15(24)7-8-16(25)26)10-14(11-13)23-18(28)30-20(4,5)6/h9-11H,7-8H2,1-6H3,(H,21,24)(H,22,27)(H,23,28)(H,25,26) |
| InChIKey | CPFFUTCWFHWAID-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |