C17H26N4O4 — CID 102133924
tert-butyl 3,5-bis(3-aminopropanoylamino)benzoate (PubChem CID 102133924) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl 3,5-bis(3-aminopropanoylamino)benzoate.
| Compound Name | tert-butyl 3,5-bis(3-aminopropanoylamino)benzoate |
|---|---|
| PubChem CID | 102133924 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl 3,5-bis(3-aminopropanoylamino)benzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(NC(=O)CCN)cc(NC(=O)CCN)c1 |
| InChI | InChI=1S/C17H26N4O4/c1-17(2,3)25-16(24)11-8-12(20-14(22)4-6-18)10-13(9-11)21-15(23)5-7-19/h8-10H,4-7,18-19H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | SGIYQJAUGRYJOD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |