C12H19N3O4 — CID 162363860
tert-butyl N-[1-(2-methoxyethyl)-6-oxopyridazin-3-yl]carbamate (PubChem CID 162363860) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is tert-butyl N-[1-(2-methoxyethyl)-6-oxopyridazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-methoxyethyl)-6-oxopyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 162363860 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | tert-butyl N-[1-(2-methoxyethyl)-6-oxopyridazin-3-yl]carbamate |
| SMILES | COCCn1nc(NC(=O)OC(C)(C)C)ccc1=O |
| InChI | InChI=1S/C12H19N3O4/c1-12(2,3)19-11(17)13-9-5-6-10(16)15(14-9)7-8-18-4/h5-6H,7-8H2,1-4H3,(H,13,14,17) |
| InChIKey | MDARRYCEWMSFCK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |