C14H23N3O4 — CID 103945933
N-(1-hydroxy-3-methylpentan-3-yl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide (PubChem CID 103945933) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylpentan-3-yl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-(1-hydroxy-3-methylpentan-3-yl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103945933 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(1-hydroxy-3-methylpentan-3-yl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCC(C)(CCO)NC(=O)c1ccc(=O)n(CCOC)n1 |
| InChI | InChI=1S/C14H23N3O4/c1-4-14(2,7-9-18)15-13(20)11-5-6-12(19)17(16-11)8-10-21-3/h5-6,18H,4,7-10H2,1-3H3,(H,15,20) |
| InChIKey | RIOMWPFKBNJMEO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |