C13H21N3O4 — CID 65114524
N-(2-hydroxy-2-methylbutyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide (PubChem CID 65114524) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylbutyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-(2-hydroxy-2-methylbutyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 65114524 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(2-hydroxy-2-methylbutyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCC(C)(O)CNC(=O)c1ccc(=O)n(CCOC)n1 |
| InChI | InChI=1S/C13H21N3O4/c1-4-13(2,19)9-14-12(18)10-5-6-11(17)16(15-10)7-8-20-3/h5-6,19H,4,7-9H2,1-3H3,(H,14,18) |
| InChIKey | GRXFHAZJWDWKEP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |