C13H19N3O5 — CID 62818105
2-[[1-(2-methoxyethyl)-6-oxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid (PubChem CID 62818105) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[[1-(2-methoxyethyl)-6-oxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid.
| Compound Name | 2-[[1-(2-methoxyethyl)-6-oxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62818105 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[[1-(2-methoxyethyl)-6-oxopyridazine-3-carbonyl]-methylamino]-2-methylpropanoic acid |
| SMILES | COCCn1nc(C(=O)N(C)C(C)(C)C(=O)O)ccc1=O |
| InChI | InChI=1S/C13H19N3O5/c1-13(2,12(19)20)15(3)11(18)9-5-6-10(17)16(14-9)7-8-21-4/h5-6H,7-8H2,1-4H3,(H,19,20) |
| InChIKey | QLISMLVNPVDUDS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |