C13H21N3O4 — CID 115771207
N-ethyl-N-(3-hydroxypropyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide (PubChem CID 115771207) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-ethyl-N-(3-hydroxypropyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-ethyl-N-(3-hydroxypropyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 115771207 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-ethyl-N-(3-hydroxypropyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCN(CCCO)C(=O)c1ccc(=O)n(CCOC)n1 |
| InChI | InChI=1S/C13H21N3O4/c1-3-15(7-4-9-17)13(19)11-5-6-12(18)16(14-11)8-10-20-2/h5-6,17H,3-4,7-10H2,1-2H3 |
| InChIKey | KFDLBKWMWZRIKQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |