C18H22BrN3O4 — CID 71873234
N-[2-(4-bromophenoxy)ethyl]-N-ethyl-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide (PubChem CID 71873234) has the molecular formula C18H22BrN3O4 and a molecular weight of 424.30 g/mol. Its IUPAC name is N-[2-(4-bromophenoxy)ethyl]-N-ethyl-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[2-(4-bromophenoxy)ethyl]-N-ethyl-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 71873234 |
| Molecular Formula | C18H22BrN3O4 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-[2-(4-bromophenoxy)ethyl]-N-ethyl-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCN(CCOc1ccc(Br)cc1)C(=O)c1ccc(=O)n(CCOC)n1 |
| InChI | InChI=1S/C18H22BrN3O4/c1-3-21(10-13-26-15-6-4-14(19)5-7-15)18(24)16-8-9-17(23)22(20-16)11-12-25-2/h4-9H,3,10-13H2,1-2H3 |
| InChIKey | MXQCZQJPHNRNHU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |