C10H16N4O3S — CID 163225686
tert-butyl N-[[5-[(Z)-N'-hydroxycarbamimidoyl]-1,3-thiazol-2-yl]methyl]carbamate (PubChem CID 163225686) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is tert-butyl N-[[5-[(Z)-N'-hydroxycarbamimidoyl]-1,3-thiazol-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[(Z)-N'-hydroxycarbamimidoyl]-1,3-thiazol-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 163225686 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | tert-butyl N-[[5-[(Z)-N'-hydroxycarbamimidoyl]-1,3-thiazol-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ncc(/C(N)=N/O)s1 |
| InChI | InChI=1S/C10H16N4O3S/c1-10(2,3)17-9(15)13-5-7-12-4-6(18-7)8(11)14-16/h4,16H,5H2,1-3H3,(H2,11,14)(H,13,15) |
| InChIKey | WWXLERDIBXOGRW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|