C13H22ClN4O2+ — CID 22141501
carbamimidoyl-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]azanium;hydrochloride (PubChem CID 22141501) has the molecular formula C13H22ClN4O2+ and a molecular weight of 301.80 g/mol. Its IUPAC name is carbamimidoyl-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]azanium;hydrochloride.
| Compound Name | carbamimidoyl-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]azanium;hydrochloride |
|---|---|
| PubChem CID | 22141501 |
| Molecular Formula | C13H22ClN4O2+ |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | carbamimidoyl-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]azanium;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)[NH2+]c1ccc(CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C13H20N4O2.ClH/c1-13(2,3)19-12(18)16-8-9-4-6-10(7-5-9)17-11(14)15;/h4-7H,8H2,1-3H3,(H,16,18)(H4,14,15,17);1H/p+1 |
| InChIKey | ALGJWXWBQMFOPX-UHFFFAOYSA-O |
| XLogP | 1.22 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|