C13H19N3O3 — CID 142092573
tert-butyl N-[(4-carbamimidoyl-3-hydroxyphenyl)methyl]carbamate (PubChem CID 142092573) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is tert-butyl N-[(4-carbamimidoyl-3-hydroxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(4-carbamimidoyl-3-hydroxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 142092573 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | tert-butyl N-[(4-carbamimidoyl-3-hydroxyphenyl)methyl]carbamate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)OC(C)(C)C)cc1O |
| InChI | InChI=1S/C13H19N3O3/c1-13(2,3)19-12(18)16-7-8-4-5-9(11(14)15)10(17)6-8/h4-6,17H,7H2,1-3H3,(H3,14,15)(H,16,18) |
| InChIKey | KPOZPUWDECKIRV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|