C18H27N3O4 — CID 153286766
2-methylpropyl N-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzenecarboximidoyl]carbamate (PubChem CID 153286766) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-methylpropyl N-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzenecarboximidoyl]carbamate.
| Compound Name | 2-methylpropyl N-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 153286766 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-methylpropyl N-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCC(C)C)c1ccc(CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27N3O4/c1-12(2)11-24-17(23)21-15(19)14-8-6-13(7-9-14)10-20-16(22)25-18(3,4)5/h6-9,12H,10-11H2,1-5H3,(H,20,22)(H2,19,21,23) |
| InChIKey | GWFYSUBSWUFIQA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|