C13H20N2O2S — CID 170764459
tert-butyl N-[[4-(methylsulfinimidoyl)phenyl]methyl]carbamate (PubChem CID 170764459) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is tert-butyl N-[[4-(methylsulfinimidoyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(methylsulfinimidoyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 170764459 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | tert-butyl N-[[4-(methylsulfinimidoyl)phenyl]methyl]carbamate |
| SMILES | [H]/N=S(\C)c1ccc(CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C13H20N2O2S/c1-13(2,3)17-12(16)15-9-10-5-7-11(8-6-10)18(4)14/h5-8,14H,9H2,1-4H3,(H,15,16) |
| InChIKey | BHTPHHUDXVIPDX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |