C38H47N7O5 — CID 166117483
tert-butyl N-[[4-[6-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]ethoxymethyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate (PubChem CID 166117483) has the molecular formula C38H47N7O5 and a molecular weight of 681.84 g/mol. Its IUPAC name is tert-butyl N-[[4-[6-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]ethoxymethyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[6-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]ethoxymethyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166117483 |
| Molecular Formula | C38H47N7O5 |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.36 |
| IUPAC Name | tert-butyl N-[[4-[6-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]ethoxymethyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate |
| SMILES | Cc1cc(-c2ncnn3cc(COCCN4CCC(c5ccc(NC6CCC(=O)NC6=O)cc5)CC4)cc23)ccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H47N7O5/c1-25-19-29(5-6-30(25)21-39-37(48)50-38(2,3)4)35-33-20-26(22-45(33)41-24-40-35)23-49-18-17-44-15-13-28(14-16-44)27-7-9-31(10-8-27)42-32-11-12-34(46)43-36(32)47/h5-10,19-20,22,24,28,32,42H,11-18,21,23H2,1-4H3,(H,39,48)(H,43,46,47) |
| InChIKey | DCIOFIUCUOFRGV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|