C39H47N7O4 — CID 174216505
tert-butyl N-[[4-[6-[2-[[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]methyl]cyclopropyl]pyrrolo[2,1-c][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate (PubChem CID 174216505) has the molecular formula C39H47N7O4 and a molecular weight of 677.85 g/mol. Its IUPAC name is tert-butyl N-[[4-[6-[2-[[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]methyl]cyclopropyl]pyrrolo[2,1-c][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[6-[2-[[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]methyl]cyclopropyl]pyrrolo[2,1-c][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 174216505 |
| Molecular Formula | C39H47N7O4 |
| Molecular Weight | 677.85 g/mol |
| Exact Mass | 677.37 |
| IUPAC Name | tert-butyl N-[[4-[6-[2-[[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]methyl]cyclopropyl]pyrrolo[2,1-c][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate |
| SMILES | Cc1cc(-c2cnnc3ccc(C4CC4CN4CCC(c5ccc(NC6CCC(=O)NC6=O)cc5)CC4)n23)ccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H47N7O4/c1-24-19-27(5-6-28(24)21-40-38(49)50-39(2,3)4)34-22-41-44-35-13-12-33(46(34)35)31-20-29(31)23-45-17-15-26(16-18-45)25-7-9-30(10-8-25)42-32-11-14-36(47)43-37(32)48/h5-10,12-13,19,22,26,29,31-32,42H,11,14-18,20-21,23H2,1-4H3,(H,40,49)(H,43,47,48) |
| InChIKey | SMDBRZZAQILKOO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 129.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.85 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|