C21H29N3O3S — CID 177363967
O-tert-butyl 4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidine-1-carbothioate (PubChem CID 177363967) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is O-tert-butyl 4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidine-1-carbothioate.
| Compound Name | O-tert-butyl 4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidine-1-carbothioate |
|---|---|
| PubChem CID | 177363967 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | O-tert-butyl 4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidine-1-carbothioate |
| SMILES | CC(C)(C)OC(=S)N1CCC(c2ccc(NC3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C21H29N3O3S/c1-21(2,3)27-20(28)24-12-10-15(11-13-24)14-4-6-16(7-5-14)22-17-8-9-18(25)23-19(17)26/h4-7,15,17,22H,8-13H2,1-3H3,(H,23,25,26) |
| InChIKey | DDJKFBRIEFKJDK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|