C36H41FN6O4 — CID 174216406
[4-[6-[(4S)-5-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-1-yl]-4-fluoropentyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methylcarbamic acid (PubChem CID 174216406) has the molecular formula C36H41FN6O4 and a molecular weight of 640.76 g/mol. Its IUPAC name is [4-[6-[(4S)-5-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-1-yl]-4-fluoropentyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methylcarbamic acid.
| Compound Name | [4-[6-[(4S)-5-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-1-yl]-4-fluoropentyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 174216406 |
| Molecular Formula | C36H41FN6O4 |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.32 |
| IUPAC Name | [4-[6-[(4S)-5-[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-1-yl]-4-fluoropentyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methylcarbamic acid |
| SMILES | Cc1cc(-c2ncnn3cc(CCC[C@H](F)CN4CCC(c5ccc(C6CCC(=O)NC6=O)cc5)CC4)cc23)ccc1CNC(=O)O |
| InChI | InChI=1S/C36H41FN6O4/c1-23-17-28(9-10-29(23)19-38-36(46)47)34-32-18-24(20-43(32)40-22-39-34)3-2-4-30(37)21-42-15-13-26(14-16-42)25-5-7-27(8-6-25)31-11-12-33(44)41-35(31)45/h5-10,17-18,20,22,26,30-31,38H,2-4,11-16,19,21H2,1H3,(H,46,47)(H,41,44,45)/t30-,31?/m0/s1 |
| InChIKey | OWIPBSYWMDQAKN-FSRLHOSWSA-N |
| XLogP | 5.53 |
| TPSA | 128.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|