C19H31N3O3SSi — CID 86717532
tert-butyl N-[2-[5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]thiophen-3-yl]carbamate (PubChem CID 86717532) has the molecular formula C19H31N3O3SSi and a molecular weight of 409.63 g/mol. Its IUPAC name is tert-butyl N-[2-[5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]thiophen-3-yl]carbamate.
| Compound Name | tert-butyl N-[2-[5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]thiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 86717532 |
| Molecular Formula | C19H31N3O3SSi |
| Molecular Weight | 409.63 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | tert-butyl N-[2-[5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]thiophen-3-yl]carbamate |
| SMILES | Cc1cc(-c2sccc2NC(=O)OC(C)(C)C)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H31N3O3SSi/c1-14-12-16(21-22(14)13-24-9-11-27(5,6)7)17-15(8-10-26-17)20-18(23)25-19(2,3)4/h8,10,12H,9,11,13H2,1-7H3,(H,20,23) |
| InChIKey | NTQZSOJLOSXJRI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|