C24H40N6O3Si — CID 171616920
tert-butyl N-[(1R,3S)-3-[3-[(3-methylpyridazin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl]carbamate (PubChem CID 171616920) has the molecular formula C24H40N6O3Si and a molecular weight of 488.71 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-[3-[(3-methylpyridazin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-[3-[(3-methylpyridazin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 171616920 |
| Molecular Formula | C24H40N6O3Si |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-[3-[(3-methylpyridazin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl]carbamate |
| SMILES | Cc1nnccc1Nc1cc([C@H]2CC[C@@H](NC(=O)OC(C)(C)C)C2)n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C24H40N6O3Si/c1-17-20(10-11-25-28-17)27-22-15-21(30(29-22)16-32-12-13-34(5,6)7)18-8-9-19(14-18)26-23(31)33-24(2,3)4/h10-11,15,18-19H,8-9,12-14,16H2,1-7H3,(H,26,31)(H,25,27,29)/t18-,19+/m0/s1 |
| InChIKey | UNPFACQOZHVKIM-RBUKOAKNSA-N |
| XLogP | 5.20 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|