C21H32N6O2 — CID 175555095
tert-butyl N-[3-[1-tert-butyl-5-(pyridazin-4-ylamino)pyrazol-3-yl]cyclopentyl]carbamate (PubChem CID 175555095) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is tert-butyl N-[3-[1-tert-butyl-5-(pyridazin-4-ylamino)pyrazol-3-yl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-tert-butyl-5-(pyridazin-4-ylamino)pyrazol-3-yl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 175555095 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | tert-butyl N-[3-[1-tert-butyl-5-(pyridazin-4-ylamino)pyrazol-3-yl]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(c2cc(Nc3ccnnc3)n(C(C)(C)C)n2)C1 |
| InChI | InChI=1S/C21H32N6O2/c1-20(2,3)27-18(24-16-9-10-22-23-13-16)12-17(26-27)14-7-8-15(11-14)25-19(28)29-21(4,5)6/h9-10,12-15H,7-8,11H2,1-6H3,(H,22,24)(H,25,28) |
| InChIKey | DVGITUWXFMWONJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |