C18H22ClN3O2 — CID 178017165
tert-butyl N-[(1S,3R)-3-(7-chloro-2,6-naphthyridin-1-yl)cyclopentyl]carbamate (PubChem CID 178017165) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-(7-chloro-2,6-naphthyridin-1-yl)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-(7-chloro-2,6-naphthyridin-1-yl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 178017165 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-(7-chloro-2,6-naphthyridin-1-yl)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](c2nccc3cnc(Cl)cc23)C1 |
| InChI | InChI=1S/C18H22ClN3O2/c1-18(2,3)24-17(23)22-13-5-4-11(8-13)16-14-9-15(19)21-10-12(14)6-7-20-16/h6-7,9-11,13H,4-5,8H2,1-3H3,(H,22,23)/t11-,13+/m1/s1 |
| InChIKey | IBTQKNHVKRHKTL-YPMHNXCESA-N |
| XLogP | 4.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|