C21H28ClN3O3 — CID 178016977
tert-butyl N-[4-(7-chloro-2,6-naphthyridin-1-yl)cyclohexyl]-N-(2-hydroxyethyl)carbamate (PubChem CID 178016977) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is tert-butyl N-[4-(7-chloro-2,6-naphthyridin-1-yl)cyclohexyl]-N-(2-hydroxyethyl)carbamate.
| Compound Name | tert-butyl N-[4-(7-chloro-2,6-naphthyridin-1-yl)cyclohexyl]-N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 178016977 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | tert-butyl N-[4-(7-chloro-2,6-naphthyridin-1-yl)cyclohexyl]-N-(2-hydroxyethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCO)C1CCC(c2nccc3cnc(Cl)cc23)CC1 |
| InChI | InChI=1S/C21H28ClN3O3/c1-21(2,3)28-20(27)25(10-11-26)16-6-4-14(5-7-16)19-17-12-18(22)24-13-15(17)8-9-23-19/h8-9,12-14,16,26H,4-7,10-11H2,1-3H3 |
| InChIKey | XLANGQOYCYRKIR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|