C19H25ClN4O2 — CID 178017026
tert-butyl (3R)-4-(7-chloro-2,6-naphthyridin-1-yl)-3-methyl-1,4-diazepane-1-carboxylate (PubChem CID 178017026) has the molecular formula C19H25ClN4O2 and a molecular weight of 376.89 g/mol. Its IUPAC name is tert-butyl (3R)-4-(7-chloro-2,6-naphthyridin-1-yl)-3-methyl-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-(7-chloro-2,6-naphthyridin-1-yl)-3-methyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 178017026 |
| Molecular Formula | C19H25ClN4O2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | tert-butyl (3R)-4-(7-chloro-2,6-naphthyridin-1-yl)-3-methyl-1,4-diazepane-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)CCCN1c1nccc2cnc(Cl)cc12 |
| InChI | InChI=1S/C19H25ClN4O2/c1-13-12-23(18(25)26-19(2,3)4)8-5-9-24(13)17-15-10-16(20)22-11-14(15)6-7-21-17/h6-7,10-11,13H,5,8-9,12H2,1-4H3/t13-/m1/s1 |
| InChIKey | GKZMZGWRUQDJLY-CYBMUJFWSA-N |
| XLogP | 4.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|