C17H24ClNO3 — CID 67148487
tert-butyl N-[2-[4-chloro-3-(hydroxymethyl)phenyl]ethyl]-N-cyclopropylcarbamate (PubChem CID 67148487) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is tert-butyl N-[2-[4-chloro-3-(hydroxymethyl)phenyl]ethyl]-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-[2-[4-chloro-3-(hydroxymethyl)phenyl]ethyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 67148487 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | tert-butyl N-[2-[4-chloro-3-(hydroxymethyl)phenyl]ethyl]-N-cyclopropylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccc(Cl)c(CO)c1)C1CC1 |
| InChI | InChI=1S/C17H24ClNO3/c1-17(2,3)22-16(21)19(14-5-6-14)9-8-12-4-7-15(18)13(10-12)11-20/h4,7,10,14,20H,5-6,8-9,11H2,1-3H3 |
| InChIKey | OITMHHUYPNCLEG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |