C18H23Cl2NO2 — CID 66761816
tert-butyl N-cyclopropyl-N-[(2,3-dichloro-5-prop-2-enylphenyl)methyl]carbamate (PubChem CID 66761816) has the molecular formula C18H23Cl2NO2 and a molecular weight of 356.29 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[(2,3-dichloro-5-prop-2-enylphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[(2,3-dichloro-5-prop-2-enylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 66761816 |
| Molecular Formula | C18H23Cl2NO2 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[(2,3-dichloro-5-prop-2-enylphenyl)methyl]carbamate |
| SMILES | C=CCc1cc(Cl)c(Cl)c(CN(C(=O)OC(C)(C)C)C2CC2)c1 |
| InChI | InChI=1S/C18H23Cl2NO2/c1-5-6-12-9-13(16(20)15(19)10-12)11-21(14-7-8-14)17(22)23-18(2,3)4/h5,9-10,14H,1,6-8,11H2,2-4H3 |
| InChIKey | GWEBZHTXIDPQHX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|