C15H19BrClNO2 — CID 162786554
tert-butyl N-[(2-bromo-3-chlorophenyl)methyl]-N-cyclopropylcarbamate (PubChem CID 162786554) has the molecular formula C15H19BrClNO2 and a molecular weight of 360.68 g/mol. Its IUPAC name is tert-butyl N-[(2-bromo-3-chlorophenyl)methyl]-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-[(2-bromo-3-chlorophenyl)methyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 162786554 |
| Molecular Formula | C15H19BrClNO2 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | tert-butyl N-[(2-bromo-3-chlorophenyl)methyl]-N-cyclopropylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cccc(Cl)c1Br)C1CC1 |
| InChI | InChI=1S/C15H19BrClNO2/c1-15(2,3)20-14(19)18(11-7-8-11)9-10-5-4-6-12(17)13(10)16/h4-6,11H,7-9H2,1-3H3 |
| InChIKey | XHESFGUYUHTJBC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |