C18H25BrFNO2 — CID 165413618
tert-butyl N-[(2-bromo-6-fluorophenyl)methyl]-N-cyclohexylcarbamate (PubChem CID 165413618) has the molecular formula C18H25BrFNO2 and a molecular weight of 386.31 g/mol. Its IUPAC name is tert-butyl N-[(2-bromo-6-fluorophenyl)methyl]-N-cyclohexylcarbamate.
| Compound Name | tert-butyl N-[(2-bromo-6-fluorophenyl)methyl]-N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 165413618 |
| Molecular Formula | C18H25BrFNO2 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | tert-butyl N-[(2-bromo-6-fluorophenyl)methyl]-N-cyclohexylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1c(F)cccc1Br)C1CCCCC1 |
| InChI | InChI=1S/C18H25BrFNO2/c1-18(2,3)23-17(22)21(13-8-5-4-6-9-13)12-14-15(19)10-7-11-16(14)20/h7,10-11,13H,4-6,8-9,12H2,1-3H3 |
| InChIKey | NQFPQXBNAGUFOT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |