C17H25BrFNO2 — CID 165413621
tert-butyl N-[(2-bromo-6-fluorophenyl)methyl]-N-pentylcarbamate (PubChem CID 165413621) has the molecular formula C17H25BrFNO2 and a molecular weight of 374.29 g/mol. Its IUPAC name is tert-butyl N-[(2-bromo-6-fluorophenyl)methyl]-N-pentylcarbamate.
| Compound Name | tert-butyl N-[(2-bromo-6-fluorophenyl)methyl]-N-pentylcarbamate |
|---|---|
| PubChem CID | 165413621 |
| Molecular Formula | C17H25BrFNO2 |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | tert-butyl N-[(2-bromo-6-fluorophenyl)methyl]-N-pentylcarbamate |
| SMILES | CCCCCN(Cc1c(F)cccc1Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25BrFNO2/c1-5-6-7-11-20(16(21)22-17(2,3)4)12-13-14(18)9-8-10-15(13)19/h8-10H,5-7,11-12H2,1-4H3 |
| InChIKey | HNIQACXGPWJGMG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|