C22H27ClFN3O3 — CID 55813939
tert-butyl N-[3-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate (PubChem CID 55813939) has the molecular formula C22H27ClFN3O3 and a molecular weight of 435.93 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[3-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 55813939 |
| Molecular Formula | C22H27ClFN3O3 |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | tert-butyl N-[3-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCNC(=O)Cc1c(F)cccc1Cl)Cc1cccnc1 |
| InChI | InChI=1S/C22H27ClFN3O3/c1-22(2,3)30-21(29)27(15-16-7-5-10-25-14-16)12-6-11-26-20(28)13-17-18(23)8-4-9-19(17)24/h4-5,7-10,14H,6,11-13,15H2,1-3H3,(H,26,28) |
| InChIKey | BJSQBTROQDUTMF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|