C21H31N5O3 — CID 55993050
tert-butyl N-(pyridin-3-ylmethyl)-N-[3-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]propyl]carbamate (PubChem CID 55993050) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is tert-butyl N-(pyridin-3-ylmethyl)-N-[3-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-(pyridin-3-ylmethyl)-N-[3-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 55993050 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | tert-butyl N-(pyridin-3-ylmethyl)-N-[3-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]propyl]carbamate |
| SMILES | Cc1nn(C)c(C)c1C(=O)NCCCN(Cc1cccnc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N5O3/c1-15-18(16(2)25(6)24-15)19(27)23-11-8-12-26(20(28)29-21(3,4)5)14-17-9-7-10-22-13-17/h7,9-10,13H,8,11-12,14H2,1-6H3,(H,23,27) |
| InChIKey | VWNWAEAQCNSHQV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|