C23H27ClN4O3 — CID 60528039
tert-butyl N-[3-[(5-chloro-1H-indole-2-carbonyl)amino]propyl]-N-(pyridin-3-ylmethyl)carbamate (PubChem CID 60528039) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-chloro-1H-indole-2-carbonyl)amino]propyl]-N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[3-[(5-chloro-1H-indole-2-carbonyl)amino]propyl]-N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 60528039 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | tert-butyl N-[3-[(5-chloro-1H-indole-2-carbonyl)amino]propyl]-N-(pyridin-3-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCNC(=O)c1cc2cc(Cl)ccc2[nH]1)Cc1cccnc1 |
| InChI | InChI=1S/C23H27ClN4O3/c1-23(2,3)31-22(30)28(15-16-6-4-9-25-14-16)11-5-10-26-21(29)20-13-17-12-18(24)7-8-19(17)27-20/h4,6-9,12-14,27H,5,10-11,15H2,1-3H3,(H,26,29) |
| InChIKey | VWCVXHXEWRMWDT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|