C24H33N3O4S — CID 55886059
tert-butyl N-[3-[2-(4-methoxyphenyl)sulfanylpropanoylamino]propyl]-N-(pyridin-3-ylmethyl)carbamate (PubChem CID 55886059) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(4-methoxyphenyl)sulfanylpropanoylamino]propyl]-N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[3-[2-(4-methoxyphenyl)sulfanylpropanoylamino]propyl]-N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 55886059 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | tert-butyl N-[3-[2-(4-methoxyphenyl)sulfanylpropanoylamino]propyl]-N-(pyridin-3-ylmethyl)carbamate |
| SMILES | COc1ccc(SC(C)C(=O)NCCCN(Cc2cccnc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H33N3O4S/c1-18(32-21-11-9-20(30-5)10-12-21)22(28)26-14-7-15-27(23(29)31-24(2,3)4)17-19-8-6-13-25-16-19/h6,8-13,16,18H,7,14-15,17H2,1-5H3,(H,26,28) |
| InChIKey | OWJVBANJTLIMEW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|