C18H30IN5O2 — CID 110927276
tert-butyl N-(pyridin-3-ylmethyl)-N-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]carbamate;hydroiodide (PubChem CID 110927276) has the molecular formula C18H30IN5O2 and a molecular weight of 475.38 g/mol. Its IUPAC name is tert-butyl N-(pyridin-3-ylmethyl)-N-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-(pyridin-3-ylmethyl)-N-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110927276 |
| Molecular Formula | C18H30IN5O2 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | tert-butyl N-(pyridin-3-ylmethyl)-N-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]carbamate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N(CCCNC1=NCCCN1)Cc1cccnc1.I |
| InChI | InChI=1S/C18H29N5O2.HI/c1-18(2,3)25-17(24)23(14-15-7-4-8-19-13-15)12-6-11-22-16-20-9-5-10-21-16;/h4,7-8,13H,5-6,9-12,14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | UGGZFNSBCJGRRX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|