C22H29N3O4 — CID 68692643
tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-[3-(pyridin-3-ylmethylamino)propyl]carbamate (PubChem CID 68692643) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-[3-(pyridin-3-ylmethylamino)propyl]carbamate.
| Compound Name | tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-[3-(pyridin-3-ylmethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 68692643 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-[3-(pyridin-3-ylmethylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCNCc1cccnc1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H29N3O4/c1-22(2,3)29-21(26)25(11-5-10-24-14-18-6-4-9-23-13-18)15-17-7-8-19-20(12-17)28-16-27-19/h4,6-9,12-13,24H,5,10-11,14-16H2,1-3H3 |
| InChIKey | HWCQAXIBAQBOAZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|