C31H32N4O3 — CID 44536274
N-(1,3-benzodioxol-5-ylmethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]-2-pyridin-3-ylacetamide (PubChem CID 44536274) has the molecular formula C31H32N4O3 and a molecular weight of 508.62 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]-2-pyridin-3-ylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 44536274 |
| Molecular Formula | C31H32N4O3 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]-2-pyridin-3-ylacetamide |
| SMILES | CCCNCc1ccc(-c2ccc(CN(Cc3ccc4c(c3)OCO4)C(=O)Cc3cccnc3)cc2)nc1 |
| InChI | InChI=1S/C31H32N4O3/c1-2-13-32-18-26-7-11-28(34-19-26)27-9-5-23(6-10-27)20-35(31(36)16-24-4-3-14-33-17-24)21-25-8-12-29-30(15-25)38-22-37-29/h3-12,14-15,17,19,32H,2,13,16,18,20-22H2,1H3 |
| InChIKey | GUUMRIKXOIAPJT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|