C23H24N2O3 — CID 11921808
2-(1,3-benzodioxol-5-yl)-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 11921808) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 11921808 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N(Cc1cccnc1)C[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C23H24N2O3/c26-23(11-17-4-6-21-22(10-17)28-15-27-21)25(13-18-2-1-7-24-12-18)14-20-9-16-3-5-19(20)8-16/h1-7,10,12,16,19-20H,8-9,11,13-15H2/t16-,19+,20-/m1/s1 |
| InChIKey | KZWDGUWPKYHJNG-LSTHTHJFSA-N |
| XLogP | 3.59 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|