C22H30N2O — CID 18557463
N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-cyclohexyl-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 18557463) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-cyclohexyl-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-cyclohexyl-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18557463 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-cyclohexyl-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(CC1CCCCC1)N(Cc1cccnc1)C[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C22H30N2O/c25-22(13-17-5-2-1-3-6-17)24(15-19-7-4-10-23-14-19)16-21-12-18-8-9-20(21)11-18/h4,7-10,14,17-18,20-21H,1-3,5-6,11-13,15-16H2/t18-,20-,21+/m0/s1 |
| InChIKey | DTCVDXLJDIUVFZ-SESVDKBCSA-N |
| XLogP | 4.59 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|