C20H22N4O — CID 11921659
N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methyl-N-(pyridin-3-ylmethyl)pyrazine-2-carboxamide (PubChem CID 11921659) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methyl-N-(pyridin-3-ylmethyl)pyrazine-2-carboxamide.
| Compound Name | N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methyl-N-(pyridin-3-ylmethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11921659 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methyl-N-(pyridin-3-ylmethyl)pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)N(Cc2cccnc2)C[C@@H]2C[C@@H]3C=C[C@H]2C3)cn1 |
| InChI | InChI=1S/C20H22N4O/c1-14-9-23-19(11-22-14)20(25)24(12-16-3-2-6-21-10-16)13-18-8-15-4-5-17(18)7-15/h2-6,9-11,15,17-18H,7-8,12-13H2,1H3/t15-,17+,18+/m1/s1 |
| InChIKey | SJXVXRSOOINARO-NJAFHUGGSA-N |
| XLogP | 3.03 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|