C24H23N3O — CID 11921666
N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(pyridin-3-ylmethyl)isoquinoline-1-carboxamide (PubChem CID 11921666) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(pyridin-3-ylmethyl)isoquinoline-1-carboxamide.
| Compound Name | N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(pyridin-3-ylmethyl)isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 11921666 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N-(pyridin-3-ylmethyl)isoquinoline-1-carboxamide |
| SMILES | O=C(c1nccc2ccccc12)N(Cc1cccnc1)C[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C24H23N3O/c28-24(23-22-6-2-1-5-19(22)9-11-26-23)27(15-18-4-3-10-25-14-18)16-21-13-17-7-8-20(21)12-17/h1-11,14,17,20-21H,12-13,15-16H2/t17-,20+,21-/m1/s1 |
| InChIKey | QCPKNBBGQUIWDD-JRGCBEDISA-N |
| XLogP | 4.48 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|