C22H36N2O2 — CID 18557473
N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-cyclohexyl-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 18557473) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-cyclohexyl-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-cyclohexyl-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 18557473 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-cyclohexyl-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | O=C(CC1CCCCC1)N(CCN1CCOCC1)C[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C22H36N2O2/c25-22(16-18-4-2-1-3-5-18)24(9-8-23-10-12-26-13-11-23)17-21-15-19-6-7-20(21)14-19/h6-7,18-21H,1-5,8-17H2/t19-,20+,21+/m0/s1 |
| InChIKey | YZKCFGMDTXZWPW-PWRODBHTSA-N |
| XLogP | 3.33 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|