C15H29N3O2 — CID 144603338
1-[(1R,2S)-2-[[amino(2-morpholin-4-ylethyl)amino]methyl]cyclohexyl]ethanone (PubChem CID 144603338) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[[amino(2-morpholin-4-ylethyl)amino]methyl]cyclohexyl]ethanone.
| Compound Name | 1-[(1R,2S)-2-[[amino(2-morpholin-4-ylethyl)amino]methyl]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 144603338 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 1-[(1R,2S)-2-[[amino(2-morpholin-4-ylethyl)amino]methyl]cyclohexyl]ethanone |
| SMILES | CC(=O)[C@@H]1CCCC[C@@H]1CN(N)CCN1CCOCC1 |
| InChI | InChI=1S/C15H29N3O2/c1-13(19)15-5-3-2-4-14(15)12-18(16)7-6-17-8-10-20-11-9-17/h14-15H,2-12,16H2,1H3/t14-,15+/m1/s1 |
| InChIKey | UTUKWIQSEAFYAL-CABCVRRESA-N |
| XLogP | 0.89 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|