C17H18N2O3 — CID 99926874
2-(1,3-benzodioxol-5-yl)-N-[(2R)-1-pyridin-3-ylpropan-2-yl]acetamide (PubChem CID 99926874) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(2R)-1-pyridin-3-ylpropan-2-yl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(2R)-1-pyridin-3-ylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 99926874 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(2R)-1-pyridin-3-ylpropan-2-yl]acetamide |
| SMILES | C[C@H](Cc1cccnc1)NC(=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H18N2O3/c1-12(7-14-3-2-6-18-10-14)19-17(20)9-13-4-5-15-16(8-13)22-11-21-15/h2-6,8,10,12H,7,9,11H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | YJHSSTRNPOKGIB-GFCCVEGCSA-N |
| XLogP | 2.10 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |