C19H22N2O5 — CID 99784502
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(1R)-2,2-dimethoxy-1-pyridin-3-ylethyl]acetamide (PubChem CID 99784502) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(1R)-2,2-dimethoxy-1-pyridin-3-ylethyl]acetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(1R)-2,2-dimethoxy-1-pyridin-3-ylethyl]acetamide |
|---|---|
| PubChem CID | 99784502 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(1R)-2,2-dimethoxy-1-pyridin-3-ylethyl]acetamide |
| SMILES | COC(OC)[C@H](NC(=O)Cc1ccc2c(c1)OCCO2)c1cccnc1 |
| InChI | InChI=1S/C19H22N2O5/c1-23-19(24-2)18(14-4-3-7-20-12-14)21-17(22)11-13-5-6-15-16(10-13)26-9-8-25-15/h3-7,10,12,18-19H,8-9,11H2,1-2H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | BMUHBMWSZBXIDD-GOSISDBHSA-N |
| XLogP | 1.87 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|